C24H33FN8O2S — CID 25101893
4-[2-[[4-(5-aminopentylamino)-6-(3-fluoroanilino)-1,3,5-triazin-2-yl]amino]ethyl]-N,N-dimethylbenzenesulfonamide (PubChem CID 25101893) has the molecular formula C24H33FN8O2S and a molecular weight of 516.65 g/mol. Its IUPAC name is 4-[2-[[4-(5-aminopentylamino)-6-(3-fluoroanilino)-1,3,5-triazin-2-yl]amino]ethyl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-[2-[[4-(5-aminopentylamino)-6-(3-fluoroanilino)-1,3,5-triazin-2-yl]amino]ethyl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 25101893 |
| Molecular Formula | C24H33FN8O2S |
| Molecular Weight | 516.65 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | 4-[2-[[4-(5-aminopentylamino)-6-(3-fluoroanilino)-1,3,5-triazin-2-yl]amino]ethyl]-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(CCNc2nc(NCCCCCN)nc(Nc3cccc(F)c3)n2)cc1 |
| InChI | InChI=1S/C24H33FN8O2S/c1-33(2)36(34,35)21-11-9-18(10-12-21)13-16-28-23-30-22(27-15-5-3-4-14-26)31-24(32-23)29-20-8-6-7-19(25)17-20/h6-12,17H,3-5,13-16,26H2,1-2H3,(H3,27,28,29,30,31,32) |
| InChIKey | WUZVWACEKVZFSR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 138.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.65 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|