C21H19N5O — CID 117082238
4-[2-[[2-(isoquinolin-1-ylamino)pyrimidin-4-yl]amino]ethyl]phenol (PubChem CID 117082238) has the molecular formula C21H19N5O and a molecular weight of 357.42 g/mol. Its IUPAC name is 4-[2-[[2-(isoquinolin-1-ylamino)pyrimidin-4-yl]amino]ethyl]phenol.
| Compound Name | 4-[2-[[2-(isoquinolin-1-ylamino)pyrimidin-4-yl]amino]ethyl]phenol |
|---|---|
| PubChem CID | 117082238 |
| Molecular Formula | C21H19N5O |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 4-[2-[[2-(isoquinolin-1-ylamino)pyrimidin-4-yl]amino]ethyl]phenol |
| SMILES | Oc1ccc(CCNc2ccnc(Nc3nccc4ccccc34)n2)cc1 |
| InChI | InChI=1S/C21H19N5O/c27-17-7-5-15(6-8-17)9-12-22-19-11-14-24-21(25-19)26-20-18-4-2-1-3-16(18)10-13-23-20/h1-8,10-11,13-14,27H,9,12H2,(H2,22,23,24,25,26) |
| InChIKey | MSODGIPVGODWAY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 82.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |