C14H15N5O2S — CID 58891102
4-[[5-methyl-4-(prop-2-ynylamino)pyrimidin-2-yl]amino]benzenesulfonamide (PubChem CID 58891102) has the molecular formula C14H15N5O2S and a molecular weight of 317.37 g/mol. Its IUPAC name is 4-[[5-methyl-4-(prop-2-ynylamino)pyrimidin-2-yl]amino]benzenesulfonamide.
| Compound Name | 4-[[5-methyl-4-(prop-2-ynylamino)pyrimidin-2-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 58891102 |
| Molecular Formula | C14H15N5O2S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 4-[[5-methyl-4-(prop-2-ynylamino)pyrimidin-2-yl]amino]benzenesulfonamide |
| SMILES | C#CCNc1nc(Nc2ccc(S(N)(=O)=O)cc2)ncc1C |
| InChI | InChI=1S/C14H15N5O2S/c1-3-8-16-13-10(2)9-17-14(19-13)18-11-4-6-12(7-5-11)22(15,20)21/h1,4-7,9H,8H2,2H3,(H2,15,20,21)(H2,16,17,18,19) |
| InChIKey | VQBXAPSEVNDNTL-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|