C14H14N4 — CID 55127965
3-[(2-pyridin-2-ylethylamino)methyl]pyridine-2-carbonitrile (PubChem CID 55127965) has the molecular formula C14H14N4 and a molecular weight of 238.29 g/mol. Its IUPAC name is 3-[(2-pyridin-2-ylethylamino)methyl]pyridine-2-carbonitrile.
| Compound Name | 3-[(2-pyridin-2-ylethylamino)methyl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 55127965 |
| Molecular Formula | C14H14N4 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 3-[(2-pyridin-2-ylethylamino)methyl]pyridine-2-carbonitrile |
| SMILES | N#Cc1ncccc1CNCCc1ccccn1 |
| InChI | InChI=1S/C14H14N4/c15-10-14-12(4-3-8-18-14)11-16-9-6-13-5-1-2-7-17-13/h1-5,7-8,16H,6,9,11H2 |
| InChIKey | AYRCQUCZSYJFTB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|