C11H9BrN4S — CID 103468530
5-amino-6-[(4-bromothiophen-2-yl)methylamino]pyridine-3-carbonitrile (PubChem CID 103468530) has the molecular formula C11H9BrN4S and a molecular weight of 309.19 g/mol. Its IUPAC name is 5-amino-6-[(4-bromothiophen-2-yl)methylamino]pyridine-3-carbonitrile.
| Compound Name | 5-amino-6-[(4-bromothiophen-2-yl)methylamino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 103468530 |
| Molecular Formula | C11H9BrN4S |
| Molecular Weight | 309.19 g/mol |
| Exact Mass | 307.97 |
| IUPAC Name | 5-amino-6-[(4-bromothiophen-2-yl)methylamino]pyridine-3-carbonitrile |
| SMILES | N#Cc1cnc(NCc2cc(Br)cs2)c(N)c1 |
| InChI | InChI=1S/C11H9BrN4S/c12-8-2-9(17-6-8)5-16-11-10(14)1-7(3-13)4-15-11/h1-2,4,6H,5,14H2,(H,15,16) |
| InChIKey | NUUUECYXYJLXKJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.19 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |