C12H15N3O — CID 82570231
1-N-(2-methoxyethyl)isoquinoline-1,5-diamine (PubChem CID 82570231) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is 1-N-(2-methoxyethyl)isoquinoline-1,5-diamine.
| Compound Name | 1-N-(2-methoxyethyl)isoquinoline-1,5-diamine |
|---|---|
| PubChem CID | 82570231 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 1-N-(2-methoxyethyl)isoquinoline-1,5-diamine |
| SMILES | COCCNc1nccc2c(N)cccc12 |
| InChI | InChI=1S/C12H15N3O/c1-16-8-7-15-12-10-3-2-4-11(13)9(10)5-6-14-12/h2-6H,7-8,13H2,1H3,(H,14,15) |
| InChIKey | MWKDMMGNIHWVHT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|