About 2-[4-(1-adamantyl)-1,3-thiazol-2-yl]-N-benzylacetamide
2-[4-(1-adamantyl)-1,3-thiazol-2-yl]-N-benzylacetamide (PubChem CID 9232942) has the molecular formula C22H26N2OS
and a molecular weight of 366.53 g/mol. Its IUPAC name is 2-[4-(1-adamantyl)-1,3-thiazol-2-yl]-N-benzylacetamide.
Molecular Properties
| Compound Name | 2-[4-(1-adamantyl)-1,3-thiazol-2-yl]-N-benzylacetamide |
| PubChem CID | 9232942 |
| Molecular Formula | C22H26N2OS |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 2-[4-(1-adamantyl)-1,3-thiazol-2-yl]-N-benzylacetamide |
| SMILES | O=C(Cc1nc(C23CC4CC(CC(C4)C2)C3)cs1)NCc1ccccc1 |
| InChI | InChI=1S/C22H26N2OS/c25-20(23-13-15-4-2-1-3-5-15)9-21-24-19(14-26-21)22-10-16-6-17(11-22)8-18(7-16)12-22/h1-5,14,16-18H,6-13H2,(H,23,25) |
| InChIKey | SUDHQDDZJRVMJR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[4-(1-adamantyl)-1,3-thiazol-2-yl]-N-benzylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(1-adamantyl)-1,3-thiazol-2-yl]-N-benzylacetamide?
The IUPAC name of 2-[4-(1-adamantyl)-1,3-thiazol-2-yl]-N-benzylacetamide (CID 9232942) is 2-[4-(1-adamantyl)-1,3-thiazol-2-yl]-N-benzylacetamide.
What is the SMILES notation for 2-[4-(1-adamantyl)-1,3-thiazol-2-yl]-N-benzylacetamide?
The canonical SMILES for 2-[4-(1-adamantyl)-1,3-thiazol-2-yl]-N-benzylacetamide is O=C(Cc1nc(C23CC4CC(CC(C4)C2)C3)cs1)NCc1ccccc1.
What is the InChIKey of 2-[4-(1-adamantyl)-1,3-thiazol-2-yl]-N-benzylacetamide?
The InChIKey is SUDHQDDZJRVMJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26N2OS/c25-20(23-13-15-4-2-1-3-5-15)9-21-24-19(14-26-21)22-10-16-6-17(11-22)8-18(7-16)12-22/h1-5,14,16-18H,6-13H2,(H,23,25).
What are the key properties of 2-[4-(1-adamantyl)-1,3-thiazol-2-yl]-N-benzylacetamide?
2-[4-(1-adamantyl)-1,3-thiazol-2-yl]-N-benzylacetamide has a molecular weight of 366.53 g/mol, XLogP of 4.47, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(1-adamantyl)-1,3-thiazol-2-yl]-N-benzylacetamide is sourced from PubChem (CID 9232942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).