C26H28N4O3S — CID 24575826
N-[4-(1-adamantyl)-1,3-thiazol-2-yl]-2-(2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl)acetamide (PubChem CID 24575826) has the molecular formula C26H28N4O3S and a molecular weight of 476.60 g/mol. Its IUPAC name is N-[4-(1-adamantyl)-1,3-thiazol-2-yl]-2-(2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl)acetamide.
| Compound Name | N-[4-(1-adamantyl)-1,3-thiazol-2-yl]-2-(2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl)acetamide |
|---|---|
| PubChem CID | 24575826 |
| Molecular Formula | C26H28N4O3S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | N-[4-(1-adamantyl)-1,3-thiazol-2-yl]-2-(2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl)acetamide |
| SMILES | O=C(CN1C(=O)NC2(CCc3ccccc32)C1=O)Nc1nc(C23CC4CC(CC(C4)C2)C3)cs1 |
| InChI | InChI=1S/C26H28N4O3S/c31-21(13-30-22(32)26(29-24(30)33)6-5-18-3-1-2-4-19(18)26)28-23-27-20(14-34-23)25-10-15-7-16(11-25)9-17(8-15)12-25/h1-4,14-17H,5-13H2,(H,29,33)(H,27,28,31) |
| InChIKey | ACRVZTVVNHZZHW-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|