C22H20N4O3S2 — CID 24570361
N-[4-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-2-yl]-2-(2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl)acetamide (PubChem CID 24570361) has the molecular formula C22H20N4O3S2 and a molecular weight of 452.56 g/mol. Its IUPAC name is N-[4-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-2-yl]-2-(2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl)acetamide.
| Compound Name | N-[4-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-2-yl]-2-(2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl)acetamide |
|---|---|
| PubChem CID | 24570361 |
| Molecular Formula | C22H20N4O3S2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | N-[4-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-2-yl]-2-(2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl)acetamide |
| SMILES | Cc1cc(-c2csc(NC(=O)CN3C(=O)NC4(CCc5ccccc54)C3=O)n2)c(C)s1 |
| InChI | InChI=1S/C22H20N4O3S2/c1-12-9-15(13(2)31-12)17-11-30-20(23-17)24-18(27)10-26-19(28)22(25-21(26)29)8-7-14-5-3-4-6-16(14)22/h3-6,9,11H,7-8,10H2,1-2H3,(H,25,29)(H,23,24,27) |
| InChIKey | JIFJEKZANDCGEP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|