C16H17N5O4 — CID 95383351
4-[(4S)-1-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-4-methyl-2,5-dioxoimidazolidin-4-yl]benzamide (PubChem CID 95383351) has the molecular formula C16H17N5O4 and a molecular weight of 343.34 g/mol. Its IUPAC name is 4-[(4S)-1-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-4-methyl-2,5-dioxoimidazolidin-4-yl]benzamide.
| Compound Name | 4-[(4S)-1-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-4-methyl-2,5-dioxoimidazolidin-4-yl]benzamide |
|---|---|
| PubChem CID | 95383351 |
| Molecular Formula | C16H17N5O4 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 4-[(4S)-1-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-4-methyl-2,5-dioxoimidazolidin-4-yl]benzamide |
| SMILES | CCc1nc(CN2C(=O)N[C@@](C)(c3ccc(C(N)=O)cc3)C2=O)no1 |
| InChI | InChI=1S/C16H17N5O4/c1-3-12-18-11(20-25-12)8-21-14(23)16(2,19-15(21)24)10-6-4-9(5-7-10)13(17)22/h4-7H,3,8H2,1-2H3,(H2,17,22)(H,19,24)/t16-/m0/s1 |
| InChIKey | AZXSTEIHMFTLRV-INIZCTEOSA-N |
| XLogP | 0.70 |
| TPSA | 131.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|