C14H14FN7O2 — CID 94821877
(5R)-3-[(4,6-diamino-1,3,5-triazin-2-yl)methyl]-5-(2-fluorophenyl)-5-methylimidazolidine-2,4-dione (PubChem CID 94821877) has the molecular formula C14H14FN7O2 and a molecular weight of 331.31 g/mol. Its IUPAC name is (5R)-3-[(4,6-diamino-1,3,5-triazin-2-yl)methyl]-5-(2-fluorophenyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-[(4,6-diamino-1,3,5-triazin-2-yl)methyl]-5-(2-fluorophenyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 94821877 |
| Molecular Formula | C14H14FN7O2 |
| Molecular Weight | 331.31 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | (5R)-3-[(4,6-diamino-1,3,5-triazin-2-yl)methyl]-5-(2-fluorophenyl)-5-methylimidazolidine-2,4-dione |
| SMILES | C[C@]1(c2ccccc2F)NC(=O)N(Cc2nc(N)nc(N)n2)C1=O |
| InChI | InChI=1S/C14H14FN7O2/c1-14(7-4-2-3-5-8(7)15)10(23)22(13(24)21-14)6-9-18-11(16)20-12(17)19-9/h2-5H,6H2,1H3,(H,21,24)(H4,16,17,18,19,20)/t14-/m1/s1 |
| InChIKey | ADQWJAFUYLGZBU-CQSZACIVSA-N |
| XLogP | 0.14 |
| TPSA | 140.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.31 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|