C13H15FN2O4S — CID 95589593
(5R)-5-(2-fluorophenyl)-5-methyl-3-(2-methylsulfonylethyl)imidazolidine-2,4-dione (PubChem CID 95589593) has the molecular formula C13H15FN2O4S and a molecular weight of 314.34 g/mol. Its IUPAC name is (5R)-5-(2-fluorophenyl)-5-methyl-3-(2-methylsulfonylethyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-5-(2-fluorophenyl)-5-methyl-3-(2-methylsulfonylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95589593 |
| Molecular Formula | C13H15FN2O4S |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | (5R)-5-(2-fluorophenyl)-5-methyl-3-(2-methylsulfonylethyl)imidazolidine-2,4-dione |
| SMILES | C[C@]1(c2ccccc2F)NC(=O)N(CCS(C)(=O)=O)C1=O |
| InChI | InChI=1S/C13H15FN2O4S/c1-13(9-5-3-4-6-10(9)14)11(17)16(12(18)15-13)7-8-21(2,19)20/h3-6H,7-8H2,1-2H3,(H,15,18)/t13-/m1/s1 |
| InChIKey | YHKPICLIGRGYFI-CYBMUJFWSA-N |
| XLogP | 0.64 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|