C19H17F3N2O4S — CID 51951254
(5R)-3-[2-(benzenesulfonyl)ethyl]-5-methyl-5-[2-(trifluoromethyl)phenyl]imidazolidine-2,4-dione (PubChem CID 51951254) has the molecular formula C19H17F3N2O4S and a molecular weight of 426.42 g/mol. Its IUPAC name is (5R)-3-[2-(benzenesulfonyl)ethyl]-5-methyl-5-[2-(trifluoromethyl)phenyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-3-[2-(benzenesulfonyl)ethyl]-5-methyl-5-[2-(trifluoromethyl)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 51951254 |
| Molecular Formula | C19H17F3N2O4S |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | (5R)-3-[2-(benzenesulfonyl)ethyl]-5-methyl-5-[2-(trifluoromethyl)phenyl]imidazolidine-2,4-dione |
| SMILES | C[C@]1(c2ccccc2C(F)(F)F)NC(=O)N(CCS(=O)(=O)c2ccccc2)C1=O |
| InChI | InChI=1S/C19H17F3N2O4S/c1-18(14-9-5-6-10-15(14)19(20,21)22)16(25)24(17(26)23-18)11-12-29(27,28)13-7-3-2-4-8-13/h2-10H,11-12H2,1H3,(H,23,26)/t18-/m1/s1 |
| InChIKey | CYYUFCGYFKPEHE-GOSISDBHSA-N |
| XLogP | 2.95 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|