C19H18F2N2O6S — CID 46796670
phenyl 2-[4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]ethanesulfonate (PubChem CID 46796670) has the molecular formula C19H18F2N2O6S and a molecular weight of 440.42 g/mol. Its IUPAC name is phenyl 2-[4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]ethanesulfonate.
| Compound Name | phenyl 2-[4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]ethanesulfonate |
|---|---|
| PubChem CID | 46796670 |
| Molecular Formula | C19H18F2N2O6S |
| Molecular Weight | 440.42 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | phenyl 2-[4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]ethanesulfonate |
| SMILES | CC1(c2ccc(OC(F)F)cc2)NC(=O)N(CCS(=O)(=O)Oc2ccccc2)C1=O |
| InChI | InChI=1S/C19H18F2N2O6S/c1-19(13-7-9-14(10-8-13)28-17(20)21)16(24)23(18(25)22-19)11-12-30(26,27)29-15-5-3-2-4-6-15/h2-10,17H,11-12H2,1H3,(H,22,25) |
| InChIKey | OTDDAFISHNLOQV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|