C18H16ClFN2O5S — CID 56519738
phenyl 2-[4-(2-chloro-4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]ethanesulfonate (PubChem CID 56519738) has the molecular formula C18H16ClFN2O5S and a molecular weight of 426.85 g/mol. Its IUPAC name is phenyl 2-[4-(2-chloro-4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]ethanesulfonate.
| Compound Name | phenyl 2-[4-(2-chloro-4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]ethanesulfonate |
|---|---|
| PubChem CID | 56519738 |
| Molecular Formula | C18H16ClFN2O5S |
| Molecular Weight | 426.85 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | phenyl 2-[4-(2-chloro-4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]ethanesulfonate |
| SMILES | CC1(c2ccc(F)cc2Cl)NC(=O)N(CCS(=O)(=O)Oc2ccccc2)C1=O |
| InChI | InChI=1S/C18H16ClFN2O5S/c1-18(14-8-7-12(20)11-15(14)19)16(23)22(17(24)21-18)9-10-28(25,26)27-13-5-3-2-4-6-13/h2-8,11H,9-10H2,1H3,(H,21,24) |
| InChIKey | NNHSNDFCTASBGG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.85 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|