C12H10ClN3O2 — CID 2691195
2-[(4S)-4-(2-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetonitrile (PubChem CID 2691195) has the molecular formula C12H10ClN3O2 and a molecular weight of 263.68 g/mol. Its IUPAC name is 2-[(4S)-4-(2-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetonitrile.
| Compound Name | 2-[(4S)-4-(2-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 2691195 |
| Molecular Formula | C12H10ClN3O2 |
| Molecular Weight | 263.68 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 2-[(4S)-4-(2-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetonitrile |
| SMILES | C[C@@]1(c2ccccc2Cl)NC(=O)N(CC#N)C1=O |
| InChI | InChI=1S/C12H10ClN3O2/c1-12(8-4-2-3-5-9(8)13)10(17)16(7-6-14)11(18)15-12/h2-5H,7H2,1H3,(H,15,18)/t12-/m0/s1 |
| InChIKey | WBZMIWLNAULJJP-LBPRGKRZSA-N |
| XLogP | 1.63 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.68 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|