C17H20F3N3O3 — CID 51951283
N-tert-butyl-2-[(4S)-4-methyl-2,5-dioxo-4-[2-(trifluoromethyl)phenyl]imidazolidin-1-yl]acetamide (PubChem CID 51951283) has the molecular formula C17H20F3N3O3 and a molecular weight of 371.36 g/mol. Its IUPAC name is N-tert-butyl-2-[(4S)-4-methyl-2,5-dioxo-4-[2-(trifluoromethyl)phenyl]imidazolidin-1-yl]acetamide.
| Compound Name | N-tert-butyl-2-[(4S)-4-methyl-2,5-dioxo-4-[2-(trifluoromethyl)phenyl]imidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 51951283 |
| Molecular Formula | C17H20F3N3O3 |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | N-tert-butyl-2-[(4S)-4-methyl-2,5-dioxo-4-[2-(trifluoromethyl)phenyl]imidazolidin-1-yl]acetamide |
| SMILES | CC(C)(C)NC(=O)CN1C(=O)N[C@@](C)(c2ccccc2C(F)(F)F)C1=O |
| InChI | InChI=1S/C17H20F3N3O3/c1-15(2,3)21-12(24)9-23-13(25)16(4,22-14(23)26)10-7-5-6-8-11(10)17(18,19)20/h5-8H,9H2,1-4H3,(H,21,24)(H,22,26)/t16-/m0/s1 |
| InChIKey | MGWNQOUXAMGWKZ-INIZCTEOSA-N |
| XLogP | 2.39 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|