C23H17ClF3N3O3 — CID 42964336
N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(4-methyl-4-naphthalen-1-yl-2,5-dioxoimidazolidin-1-yl)acetamide (PubChem CID 42964336) has the molecular formula C23H17ClF3N3O3 and a molecular weight of 475.85 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(4-methyl-4-naphthalen-1-yl-2,5-dioxoimidazolidin-1-yl)acetamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(4-methyl-4-naphthalen-1-yl-2,5-dioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 42964336 |
| Molecular Formula | C23H17ClF3N3O3 |
| Molecular Weight | 475.85 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(4-methyl-4-naphthalen-1-yl-2,5-dioxoimidazolidin-1-yl)acetamide |
| SMILES | CC1(c2cccc3ccccc23)NC(=O)N(CC(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C23H17ClF3N3O3/c1-22(16-8-4-6-13-5-2-3-7-15(13)16)20(32)30(21(33)29-22)12-19(31)28-14-9-10-18(24)17(11-14)23(25,26)27/h2-11H,12H2,1H3,(H,28,31)(H,29,33) |
| InChIKey | HMMBZPWNQDAUFA-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.85 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|