C18H22FN3O3 — CID 94815011
N-cyclohexyl-2-[(4S)-4-(2-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 94815011) has the molecular formula C18H22FN3O3 and a molecular weight of 347.39 g/mol. Its IUPAC name is N-cyclohexyl-2-[(4S)-4-(2-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-cyclohexyl-2-[(4S)-4-(2-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 94815011 |
| Molecular Formula | C18H22FN3O3 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | N-cyclohexyl-2-[(4S)-4-(2-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | C[C@@]1(c2ccccc2F)NC(=O)N(CC(=O)NC2CCCCC2)C1=O |
| InChI | InChI=1S/C18H22FN3O3/c1-18(13-9-5-6-10-14(13)19)16(24)22(17(25)21-18)11-15(23)20-12-7-3-2-4-8-12/h5-6,9-10,12H,2-4,7-8,11H2,1H3,(H,20,23)(H,21,25)/t18-/m0/s1 |
| InChIKey | XTRVLWJLNQDGMA-SFHVURJKSA-N |
| XLogP | 2.04 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|