C19H23F2N3O3 — CID 55374709
2-[4-(2,5-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-methylcyclohexyl)acetamide (PubChem CID 55374709) has the molecular formula C19H23F2N3O3 and a molecular weight of 379.41 g/mol. Its IUPAC name is 2-[4-(2,5-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-methylcyclohexyl)acetamide.
| Compound Name | 2-[4-(2,5-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-methylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 55374709 |
| Molecular Formula | C19H23F2N3O3 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 2-[4-(2,5-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-methylcyclohexyl)acetamide |
| SMILES | CC1CCC(NC(=O)CN2C(=O)NC(C)(c3cc(F)ccc3F)C2=O)CC1 |
| InChI | InChI=1S/C19H23F2N3O3/c1-11-3-6-13(7-4-11)22-16(25)10-24-17(26)19(2,23-18(24)27)14-9-12(20)5-8-15(14)21/h5,8-9,11,13H,3-4,6-7,10H2,1-2H3,(H,22,25)(H,23,27) |
| InChIKey | XBCPYXBYGHHFIJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|