C20H24F2N4O4 — CID 55374711
2-[4-(2,5-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(2-methylcyclohexyl)carbamoyl]acetamide (PubChem CID 55374711) has the molecular formula C20H24F2N4O4 and a molecular weight of 422.43 g/mol. Its IUPAC name is 2-[4-(2,5-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(2-methylcyclohexyl)carbamoyl]acetamide.
| Compound Name | 2-[4-(2,5-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(2-methylcyclohexyl)carbamoyl]acetamide |
|---|---|
| PubChem CID | 55374711 |
| Molecular Formula | C20H24F2N4O4 |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 2-[4-(2,5-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(2-methylcyclohexyl)carbamoyl]acetamide |
| SMILES | CC1CCCCC1NC(=O)NC(=O)CN1C(=O)NC(C)(c2cc(F)ccc2F)C1=O |
| InChI | InChI=1S/C20H24F2N4O4/c1-11-5-3-4-6-15(11)23-18(29)24-16(27)10-26-17(28)20(2,25-19(26)30)13-9-12(21)7-8-14(13)22/h7-9,11,15H,3-6,10H2,1-2H3,(H,25,30)(H2,23,24,27,29) |
| InChIKey | POFLJIKYSMKKFH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|