C20H25FN4O4 — CID 46810709
2-[3-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(2-methylcyclohexyl)carbamoyl]acetamide (PubChem CID 46810709) has the molecular formula C20H25FN4O4 and a molecular weight of 404.44 g/mol. Its IUPAC name is 2-[3-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(2-methylcyclohexyl)carbamoyl]acetamide.
| Compound Name | 2-[3-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(2-methylcyclohexyl)carbamoyl]acetamide |
|---|---|
| PubChem CID | 46810709 |
| Molecular Formula | C20H25FN4O4 |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | 2-[3-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(2-methylcyclohexyl)carbamoyl]acetamide |
| SMILES | CC1CCCCC1NC(=O)NC(=O)CN1C(=O)C(C)N(c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C20H25FN4O4/c1-12-5-3-4-6-16(12)22-19(28)23-17(26)11-24-18(27)13(2)25(20(24)29)15-9-7-14(21)8-10-15/h7-10,12-13,16H,3-6,11H2,1-2H3,(H2,22,23,26,28) |
| InChIKey | XLEFAIIVSKTCQA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|