C14H15N3O4S — CID 94180307
4-[(4R)-4-methyl-1-(2-methylsulfonylethyl)-2,5-dioxoimidazolidin-4-yl]benzonitrile (PubChem CID 94180307) has the molecular formula C14H15N3O4S and a molecular weight of 321.36 g/mol. Its IUPAC name is 4-[(4R)-4-methyl-1-(2-methylsulfonylethyl)-2,5-dioxoimidazolidin-4-yl]benzonitrile.
| Compound Name | 4-[(4R)-4-methyl-1-(2-methylsulfonylethyl)-2,5-dioxoimidazolidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 94180307 |
| Molecular Formula | C14H15N3O4S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 4-[(4R)-4-methyl-1-(2-methylsulfonylethyl)-2,5-dioxoimidazolidin-4-yl]benzonitrile |
| SMILES | C[C@]1(c2ccc(C#N)cc2)NC(=O)N(CCS(C)(=O)=O)C1=O |
| InChI | InChI=1S/C14H15N3O4S/c1-14(11-5-3-10(9-15)4-6-11)12(18)17(13(19)16-14)7-8-22(2,20)21/h3-6H,7-8H2,1-2H3,(H,16,19)/t14-/m1/s1 |
| InChIKey | KGTRHGMCZRHVBI-CQSZACIVSA-N |
| XLogP | 0.37 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|