C17H21N5O2 — CID 82147862
2-[[3-(2-aminoethyl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl]methyl]benzonitrile (PubChem CID 82147862) has the molecular formula C17H21N5O2 and a molecular weight of 327.39 g/mol. Its IUPAC name is 2-[[3-(2-aminoethyl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl]methyl]benzonitrile.
| Compound Name | 2-[[3-(2-aminoethyl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 82147862 |
| Molecular Formula | C17H21N5O2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 2-[[3-(2-aminoethyl)-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1CN1CCC2(CC1)NC(=O)N(CCN)C2=O |
| InChI | InChI=1S/C17H21N5O2/c18-7-10-22-15(23)17(20-16(22)24)5-8-21(9-6-17)12-14-4-2-1-3-13(14)11-19/h1-4H,5-10,12,18H2,(H,20,24) |
| InChIKey | LGQCMABJILMBLK-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 102.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|