C24H27N5O2 — CID 69206463
4-[[8-[(3S)-3-amino-3-phenylpropyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]methyl]benzonitrile (PubChem CID 69206463) has the molecular formula C24H27N5O2 and a molecular weight of 417.51 g/mol. Its IUPAC name is 4-[[8-[(3S)-3-amino-3-phenylpropyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]methyl]benzonitrile.
| Compound Name | 4-[[8-[(3S)-3-amino-3-phenylpropyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 69206463 |
| Molecular Formula | C24H27N5O2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 4-[[8-[(3S)-3-amino-3-phenylpropyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(CN2C(=O)NC3(CCN(CC[C@H](N)c4ccccc4)CC3)C2=O)cc1 |
| InChI | InChI=1S/C24H27N5O2/c25-16-18-6-8-19(9-7-18)17-29-22(30)24(27-23(29)31)11-14-28(15-12-24)13-10-21(26)20-4-2-1-3-5-20/h1-9,21H,10-15,17,26H2,(H,27,31)/t21-/m0/s1 |
| InChIKey | UFWDSDKPCZIKLV-NRFANRHFSA-N |
| XLogP | 2.53 |
| TPSA | 102.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|