C23H27BrN4O2 — CID 11213585
8-[(3S)-3-amino-3-phenylpropyl]-3-[(4-bromophenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 11213585) has the molecular formula C23H27BrN4O2 and a molecular weight of 471.40 g/mol. Its IUPAC name is 8-[(3S)-3-amino-3-phenylpropyl]-3-[(4-bromophenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-[(3S)-3-amino-3-phenylpropyl]-3-[(4-bromophenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 11213585 |
| Molecular Formula | C23H27BrN4O2 |
| Molecular Weight | 471.40 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | 8-[(3S)-3-amino-3-phenylpropyl]-3-[(4-bromophenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | N[C@@H](CCN1CCC2(CC1)NC(=O)N(Cc1ccc(Br)cc1)C2=O)c1ccccc1 |
| InChI | InChI=1S/C23H27BrN4O2/c24-19-8-6-17(7-9-19)16-28-21(29)23(26-22(28)30)11-14-27(15-12-23)13-10-20(25)18-4-2-1-3-5-18/h1-9,20H,10-16,25H2,(H,26,30)/t20-/m0/s1 |
| InChIKey | AKFCXHYRHUGYOR-FQEVSTJZSA-N |
| XLogP | 3.43 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|