C12H9N3O3 — CID 118182749
2-[(2,4,6-trioxo-1,3-diazinan-1-yl)methyl]benzonitrile (PubChem CID 118182749) has the molecular formula C12H9N3O3 and a molecular weight of 243.22 g/mol. Its IUPAC name is 2-[(2,4,6-trioxo-1,3-diazinan-1-yl)methyl]benzonitrile.
| Compound Name | 2-[(2,4,6-trioxo-1,3-diazinan-1-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 118182749 |
| Molecular Formula | C12H9N3O3 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 2-[(2,4,6-trioxo-1,3-diazinan-1-yl)methyl]benzonitrile |
| SMILES | N#Cc1ccccc1CN1C(=O)CC(=O)NC1=O |
| InChI | InChI=1S/C12H9N3O3/c13-6-8-3-1-2-4-9(8)7-15-11(17)5-10(16)14-12(15)18/h1-4H,5,7H2,(H,14,16,18) |
| InChIKey | RBJQTTIQCZXPSM-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|