C12H11N3O4S — CID 66084595
2-[(3,5-dioxopiperazin-1-yl)sulfonylmethyl]benzonitrile (PubChem CID 66084595) has the molecular formula C12H11N3O4S and a molecular weight of 293.30 g/mol. Its IUPAC name is 2-[(3,5-dioxopiperazin-1-yl)sulfonylmethyl]benzonitrile.
| Compound Name | 2-[(3,5-dioxopiperazin-1-yl)sulfonylmethyl]benzonitrile |
|---|---|
| PubChem CID | 66084595 |
| Molecular Formula | C12H11N3O4S |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 2-[(3,5-dioxopiperazin-1-yl)sulfonylmethyl]benzonitrile |
| SMILES | N#Cc1ccccc1CS(=O)(=O)N1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C12H11N3O4S/c13-5-9-3-1-2-4-10(9)8-20(18,19)15-6-11(16)14-12(17)7-15/h1-4H,6-8H2,(H,14,16,17) |
| InChIKey | ZASOMXJSTIAEJZ-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|