C22H24F2N2O3 — CID 46640786
5-(3,4-difluorophenyl)-5-methyl-3-[2-(3-methyl-4-propan-2-ylphenoxy)ethyl]imidazolidine-2,4-dione (PubChem CID 46640786) has the molecular formula C22H24F2N2O3 and a molecular weight of 402.44 g/mol. Its IUPAC name is 5-(3,4-difluorophenyl)-5-methyl-3-[2-(3-methyl-4-propan-2-ylphenoxy)ethyl]imidazolidine-2,4-dione.
| Compound Name | 5-(3,4-difluorophenyl)-5-methyl-3-[2-(3-methyl-4-propan-2-ylphenoxy)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 46640786 |
| Molecular Formula | C22H24F2N2O3 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 5-(3,4-difluorophenyl)-5-methyl-3-[2-(3-methyl-4-propan-2-ylphenoxy)ethyl]imidazolidine-2,4-dione |
| SMILES | Cc1cc(OCCN2C(=O)NC(C)(c3ccc(F)c(F)c3)C2=O)ccc1C(C)C |
| InChI | InChI=1S/C22H24F2N2O3/c1-13(2)17-7-6-16(11-14(17)3)29-10-9-26-20(27)22(4,25-21(26)28)15-5-8-18(23)19(24)12-15/h5-8,11-13H,9-10H2,1-4H3,(H,25,28) |
| InChIKey | BIRISMSUNJFZBO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|