C18H26N2O5 — CID 51223013
3-[3-(furan-2-ylmethoxy)-2-hydroxypropyl]-1,3-diazaspiro[4.7]dodecane-2,4-dione (PubChem CID 51223013) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is 3-[3-(furan-2-ylmethoxy)-2-hydroxypropyl]-1,3-diazaspiro[4.7]dodecane-2,4-dione.
| Compound Name | 3-[3-(furan-2-ylmethoxy)-2-hydroxypropyl]-1,3-diazaspiro[4.7]dodecane-2,4-dione |
|---|---|
| PubChem CID | 51223013 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 3-[3-(furan-2-ylmethoxy)-2-hydroxypropyl]-1,3-diazaspiro[4.7]dodecane-2,4-dione |
| SMILES | O=C1NC2(CCCCCCC2)C(=O)N1CC(O)COCc1ccco1 |
| InChI | InChI=1S/C18H26N2O5/c21-14(12-24-13-15-7-6-10-25-15)11-20-16(22)18(19-17(20)23)8-4-2-1-3-5-9-18/h6-7,10,14,21H,1-5,8-9,11-13H2,(H,19,23) |
| InChIKey | IJNQLAUDVMCXMW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 92.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|