C19H21ClN2O4S — CID 55410125
5-(4-chlorophenyl)-5-ethyl-3-[2-hydroxy-3-(thiophen-2-ylmethoxy)propyl]imidazolidine-2,4-dione (PubChem CID 55410125) has the molecular formula C19H21ClN2O4S and a molecular weight of 408.91 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-5-ethyl-3-[2-hydroxy-3-(thiophen-2-ylmethoxy)propyl]imidazolidine-2,4-dione.
| Compound Name | 5-(4-chlorophenyl)-5-ethyl-3-[2-hydroxy-3-(thiophen-2-ylmethoxy)propyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 55410125 |
| Molecular Formula | C19H21ClN2O4S |
| Molecular Weight | 408.91 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | 5-(4-chlorophenyl)-5-ethyl-3-[2-hydroxy-3-(thiophen-2-ylmethoxy)propyl]imidazolidine-2,4-dione |
| SMILES | CCC1(c2ccc(Cl)cc2)NC(=O)N(CC(O)COCc2cccs2)C1=O |
| InChI | InChI=1S/C19H21ClN2O4S/c1-2-19(13-5-7-14(20)8-6-13)17(24)22(18(25)21-19)10-15(23)11-26-12-16-4-3-9-27-16/h3-9,15,23H,2,10-12H2,1H3,(H,21,25) |
| InChIKey | FKEYHDLVNYVULP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.91 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|