C29H28N4O5 — CID 139899998
3-(3-benzyl-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-4-[4-(4-cyanophenyl)phenoxy]-N-hydroxybutanamide (PubChem CID 139899998) has the molecular formula C29H28N4O5 and a molecular weight of 512.57 g/mol. Its IUPAC name is 3-(3-benzyl-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-4-[4-(4-cyanophenyl)phenoxy]-N-hydroxybutanamide.
| Compound Name | 3-(3-benzyl-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-4-[4-(4-cyanophenyl)phenoxy]-N-hydroxybutanamide |
|---|---|
| PubChem CID | 139899998 |
| Molecular Formula | C29H28N4O5 |
| Molecular Weight | 512.57 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | 3-(3-benzyl-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-4-[4-(4-cyanophenyl)phenoxy]-N-hydroxybutanamide |
| SMILES | CC1(C)C(=O)N(C(COc2ccc(-c3ccc(C#N)cc3)cc2)CC(=O)NO)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C29H28N4O5/c1-29(2)27(35)33(28(36)32(29)18-21-6-4-3-5-7-21)24(16-26(34)31-37)19-38-25-14-12-23(13-15-25)22-10-8-20(17-30)9-11-22/h3-15,24,37H,16,18-19H2,1-2H3,(H,31,34) |
| InChIKey | KFPPEWOFUFBFHJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 122.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.57 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|