C27H39N5O4 — CID 41183692
N-(2,3-dimethylphenyl)-2-[4-[2-[(5R,9R)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetyl]piperazin-1-yl]acetamide (PubChem CID 41183692) has the molecular formula C27H39N5O4 and a molecular weight of 497.64 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-[4-[2-[(5R,9R)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetyl]piperazin-1-yl]acetamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-[4-[2-[(5R,9R)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 41183692 |
| Molecular Formula | C27H39N5O4 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.30 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-[4-[2-[(5R,9R)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetyl]piperazin-1-yl]acetamide |
| SMILES | Cc1cccc(NC(=O)CN2CCN(C(=O)CN3C(=O)N[C@@]4(C[C@H](C)CC(C)(C)C4)C3=O)CC2)c1C |
| InChI | InChI=1S/C27H39N5O4/c1-18-13-26(4,5)17-27(14-18)24(35)32(25(36)29-27)16-23(34)31-11-9-30(10-12-31)15-22(33)28-21-8-6-7-19(2)20(21)3/h6-8,18H,9-17H2,1-5H3,(H,28,33)(H,29,36)/t18-,27-/m1/s1 |
| InChIKey | WRNHTXUYSGZERJ-DNOBIOAJSA-N |
| XLogP | 2.52 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|