C21H29N5O7 — CID 41135650
[2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] 2-[(5S,9R)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate (PubChem CID 41135650) has the molecular formula C21H29N5O7 and a molecular weight of 463.49 g/mol. Its IUPAC name is [2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] 2-[(5S,9R)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate.
| Compound Name | [2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] 2-[(5S,9R)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate |
|---|---|
| PubChem CID | 41135650 |
| Molecular Formula | C21H29N5O7 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | [2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-2-oxoethyl] 2-[(5S,9R)-7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate |
| SMILES | C[C@@H]1CC(C)(C)C[C@]2(C1)NC(=O)N(CC(=O)OCC(=O)c1c(N)n(C)c(=O)n(C)c1=O)C2=O |
| InChI | InChI=1S/C21H29N5O7/c1-11-6-20(2,3)10-21(7-11)17(30)26(18(31)23-21)8-13(28)33-9-12(27)14-15(22)24(4)19(32)25(5)16(14)29/h11H,6-10,22H2,1-5H3,(H,23,31)/t11-,21+/m1/s1 |
| InChIKey | JGFSBSFNDMEKLI-FIKIJFGZSA-N |
| XLogP | -0.47 |
| TPSA | 162.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|