C23H19NO5 — CID 8647555
[2-oxo-2-[4-(2-oxopyrrolidin-1-yl)phenyl]ethyl] 3-hydroxynaphthalene-2-carboxylate (PubChem CID 8647555) has the molecular formula C23H19NO5 and a molecular weight of 389.41 g/mol. Its IUPAC name is [2-oxo-2-[4-(2-oxopyrrolidin-1-yl)phenyl]ethyl] 3-hydroxynaphthalene-2-carboxylate.
| Compound Name | [2-oxo-2-[4-(2-oxopyrrolidin-1-yl)phenyl]ethyl] 3-hydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 8647555 |
| Molecular Formula | C23H19NO5 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | [2-oxo-2-[4-(2-oxopyrrolidin-1-yl)phenyl]ethyl] 3-hydroxynaphthalene-2-carboxylate |
| SMILES | O=C(COC(=O)c1cc2ccccc2cc1O)c1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C23H19NO5/c25-20-13-17-5-2-1-4-16(17)12-19(20)23(28)29-14-21(26)15-7-9-18(10-8-15)24-11-3-6-22(24)27/h1-2,4-5,7-10,12-13,25H,3,6,11,14H2 |
| InChIKey | LNIAJDNYLWDOPZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |