C23H19NO4 — CID 8525654
[2-(benzylamino)-2-oxoethyl] 2-benzo[e][1]benzofuran-1-ylacetate (PubChem CID 8525654) has the molecular formula C23H19NO4 and a molecular weight of 373.41 g/mol. Its IUPAC name is [2-(benzylamino)-2-oxoethyl] 2-benzo[e][1]benzofuran-1-ylacetate.
| Compound Name | [2-(benzylamino)-2-oxoethyl] 2-benzo[e][1]benzofuran-1-ylacetate |
|---|---|
| PubChem CID | 8525654 |
| Molecular Formula | C23H19NO4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | [2-(benzylamino)-2-oxoethyl] 2-benzo[e][1]benzofuran-1-ylacetate |
| SMILES | O=C(COC(=O)Cc1coc2ccc3ccccc3c12)NCc1ccccc1 |
| InChI | InChI=1S/C23H19NO4/c25-21(24-13-16-6-2-1-3-7-16)15-28-22(26)12-18-14-27-20-11-10-17-8-4-5-9-19(17)23(18)20/h1-11,14H,12-13,15H2,(H,24,25) |
| InChIKey | QXTHGRPEFAPNMF-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |