C24H21NO5S — CID 24526969
[2-[5-(2-acetamidoethyl)thiophen-2-yl]-2-oxoethyl] 2-benzo[e][1]benzofuran-1-ylacetate (PubChem CID 24526969) has the molecular formula C24H21NO5S and a molecular weight of 435.50 g/mol. Its IUPAC name is [2-[5-(2-acetamidoethyl)thiophen-2-yl]-2-oxoethyl] 2-benzo[e][1]benzofuran-1-ylacetate.
| Compound Name | [2-[5-(2-acetamidoethyl)thiophen-2-yl]-2-oxoethyl] 2-benzo[e][1]benzofuran-1-ylacetate |
|---|---|
| PubChem CID | 24526969 |
| Molecular Formula | C24H21NO5S |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | [2-[5-(2-acetamidoethyl)thiophen-2-yl]-2-oxoethyl] 2-benzo[e][1]benzofuran-1-ylacetate |
| SMILES | CC(=O)NCCc1ccc(C(=O)COC(=O)Cc2coc3ccc4ccccc4c23)s1 |
| InChI | InChI=1S/C24H21NO5S/c1-15(26)25-11-10-18-7-9-22(31-18)20(27)14-30-23(28)12-17-13-29-21-8-6-16-4-2-3-5-19(16)24(17)21/h2-9,13H,10-12,14H2,1H3,(H,25,26) |
| InChIKey | SEUVNUUBOYERSQ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |