C23H18O5 — CID 7901833
methyl 4-[(2-benzo[e][1]benzofuran-1-ylacetyl)oxymethyl]benzoate (PubChem CID 7901833) has the molecular formula C23H18O5 and a molecular weight of 374.39 g/mol. Its IUPAC name is methyl 4-[(2-benzo[e][1]benzofuran-1-ylacetyl)oxymethyl]benzoate.
| Compound Name | methyl 4-[(2-benzo[e][1]benzofuran-1-ylacetyl)oxymethyl]benzoate |
|---|---|
| PubChem CID | 7901833 |
| Molecular Formula | C23H18O5 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | methyl 4-[(2-benzo[e][1]benzofuran-1-ylacetyl)oxymethyl]benzoate |
| SMILES | COC(=O)c1ccc(COC(=O)Cc2coc3ccc4ccccc4c23)cc1 |
| InChI | InChI=1S/C23H18O5/c1-26-23(25)17-8-6-15(7-9-17)13-28-21(24)12-18-14-27-20-11-10-16-4-2-3-5-19(16)22(18)20/h2-11,14H,12-13H2,1H3 |
| InChIKey | IFXHBSMFAKARTB-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |