C24H21NO6 — CID 8525666
[2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-benzo[e][1]benzofuran-1-ylacetate (PubChem CID 8525666) has the molecular formula C24H21NO6 and a molecular weight of 419.43 g/mol. Its IUPAC name is [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-benzo[e][1]benzofuran-1-ylacetate.
| Compound Name | [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-benzo[e][1]benzofuran-1-ylacetate |
|---|---|
| PubChem CID | 8525666 |
| Molecular Formula | C24H21NO6 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | [2-(3,4-dimethoxyanilino)-2-oxoethyl] 2-benzo[e][1]benzofuran-1-ylacetate |
| SMILES | COc1ccc(NC(=O)COC(=O)Cc2coc3ccc4ccccc4c23)cc1OC |
| InChI | InChI=1S/C24H21NO6/c1-28-19-10-8-17(12-21(19)29-2)25-22(26)14-31-23(27)11-16-13-30-20-9-7-15-5-3-4-6-18(15)24(16)20/h3-10,12-13H,11,14H2,1-2H3,(H,25,26) |
| InChIKey | JNSOOYVBXIOGQS-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |