C24H21NO5 — CID 8737731
[(2R)-1-(4-methoxyanilino)-1-oxopropan-2-yl] 2-benzo[e][1]benzofuran-1-ylacetate (PubChem CID 8737731) has the molecular formula C24H21NO5 and a molecular weight of 403.43 g/mol. Its IUPAC name is [(2R)-1-(4-methoxyanilino)-1-oxopropan-2-yl] 2-benzo[e][1]benzofuran-1-ylacetate.
| Compound Name | [(2R)-1-(4-methoxyanilino)-1-oxopropan-2-yl] 2-benzo[e][1]benzofuran-1-ylacetate |
|---|---|
| PubChem CID | 8737731 |
| Molecular Formula | C24H21NO5 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | [(2R)-1-(4-methoxyanilino)-1-oxopropan-2-yl] 2-benzo[e][1]benzofuran-1-ylacetate |
| SMILES | COc1ccc(NC(=O)[C@@H](C)OC(=O)Cc2coc3ccc4ccccc4c23)cc1 |
| InChI | InChI=1S/C24H21NO5/c1-15(24(27)25-18-8-10-19(28-2)11-9-18)30-22(26)13-17-14-29-21-12-7-16-5-3-4-6-20(16)23(17)21/h3-12,14-15H,13H2,1-2H3,(H,25,27)/t15-/m1/s1 |
| InChIKey | GFOGIKDRUBYFLF-OAHLLOKOSA-N |
| XLogP | 4.71 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |