C24H18N2O4 — CID 8525625
[(2R)-1-(4-cyanoanilino)-1-oxopropan-2-yl] 2-benzo[e][1]benzofuran-1-ylacetate (PubChem CID 8525625) has the molecular formula C24H18N2O4 and a molecular weight of 398.42 g/mol. Its IUPAC name is [(2R)-1-(4-cyanoanilino)-1-oxopropan-2-yl] 2-benzo[e][1]benzofuran-1-ylacetate.
| Compound Name | [(2R)-1-(4-cyanoanilino)-1-oxopropan-2-yl] 2-benzo[e][1]benzofuran-1-ylacetate |
|---|---|
| PubChem CID | 8525625 |
| Molecular Formula | C24H18N2O4 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | [(2R)-1-(4-cyanoanilino)-1-oxopropan-2-yl] 2-benzo[e][1]benzofuran-1-ylacetate |
| SMILES | C[C@@H](OC(=O)Cc1coc2ccc3ccccc3c12)C(=O)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C24H18N2O4/c1-15(24(28)26-19-9-6-16(13-25)7-10-19)30-22(27)12-18-14-29-21-11-8-17-4-2-3-5-20(17)23(18)21/h2-11,14-15H,12H2,1H3,(H,26,28)/t15-/m1/s1 |
| InChIKey | IKRZLILZQLZHLP-OAHLLOKOSA-N |
| XLogP | 4.57 |
| TPSA | 92.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |