C23H17F2NO5 — CID 29219272
[2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-benzo[e][1]benzofuran-1-ylacetate (PubChem CID 29219272) has the molecular formula C23H17F2NO5 and a molecular weight of 425.39 g/mol. Its IUPAC name is [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-benzo[e][1]benzofuran-1-ylacetate.
| Compound Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-benzo[e][1]benzofuran-1-ylacetate |
|---|---|
| PubChem CID | 29219272 |
| Molecular Formula | C23H17F2NO5 |
| Molecular Weight | 425.39 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 2-benzo[e][1]benzofuran-1-ylacetate |
| SMILES | O=C(COC(=O)Cc1coc2ccc3ccccc3c12)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C23H17F2NO5/c24-23(25)31-18-8-4-3-7-17(18)26-20(27)13-30-21(28)11-15-12-29-19-10-9-14-5-1-2-6-16(14)22(15)19/h1-10,12,23H,11,13H2,(H,26,27) |
| InChIKey | JJXZAEAOHPBTDG-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.39 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |