C16H27ClN2O — CID 119429836
4-methyl-N-[3-(methylamino)propyl]-3-phenylpentanamide;hydrochloride (PubChem CID 119429836) has the molecular formula C16H27ClN2O and a molecular weight of 298.86 g/mol. Its IUPAC name is 4-methyl-N-[3-(methylamino)propyl]-3-phenylpentanamide;hydrochloride.
| Compound Name | 4-methyl-N-[3-(methylamino)propyl]-3-phenylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 119429836 |
| Molecular Formula | C16H27ClN2O |
| Molecular Weight | 298.86 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 4-methyl-N-[3-(methylamino)propyl]-3-phenylpentanamide;hydrochloride |
| SMILES | CNCCCNC(=O)CC(c1ccccc1)C(C)C.Cl |
| InChI | InChI=1S/C16H26N2O.ClH/c1-13(2)15(14-8-5-4-6-9-14)12-16(19)18-11-7-10-17-3;/h4-6,8-9,13,15,17H,7,10-12H2,1-3H3,(H,18,19);1H |
| InChIKey | BIPLDFNYMKOKKI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.86 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|