C21H17FN4O2 — CID 27876459
N-[(Z)-[2-[(2-fluorobenzoyl)amino]-1-phenylethylidene]amino]pyridine-4-carboxamide (PubChem CID 27876459) has the molecular formula C21H17FN4O2 and a molecular weight of 376.39 g/mol. Its IUPAC name is N-[(Z)-[2-[(2-fluorobenzoyl)amino]-1-phenylethylidene]amino]pyridine-4-carboxamide.
| Compound Name | N-[(Z)-[2-[(2-fluorobenzoyl)amino]-1-phenylethylidene]amino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 27876459 |
| Molecular Formula | C21H17FN4O2 |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | N-[(Z)-[2-[(2-fluorobenzoyl)amino]-1-phenylethylidene]amino]pyridine-4-carboxamide |
| SMILES | O=C(N/N=C(\CNC(=O)c1ccccc1F)c1ccccc1)c1ccncc1 |
| InChI | InChI=1S/C21H17FN4O2/c22-18-9-5-4-8-17(18)21(28)24-14-19(15-6-2-1-3-7-15)25-26-20(27)16-10-12-23-13-11-16/h1-13H,14H2,(H,24,28)(H,26,27)/b25-19+ |
| InChIKey | NQECFXJACZNBFS-NCELDCMTSA-N |
| XLogP | 2.78 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|