C23H20ClN3O2 — CID 27876476
2-chloro-N-[(2E)-2-phenyl-2-[(2-phenylacetyl)hydrazinylidene]ethyl]benzamide (PubChem CID 27876476) has the molecular formula C23H20ClN3O2 and a molecular weight of 405.89 g/mol. Its IUPAC name is 2-chloro-N-[(2E)-2-phenyl-2-[(2-phenylacetyl)hydrazinylidene]ethyl]benzamide.
| Compound Name | 2-chloro-N-[(2E)-2-phenyl-2-[(2-phenylacetyl)hydrazinylidene]ethyl]benzamide |
|---|---|
| PubChem CID | 27876476 |
| Molecular Formula | C23H20ClN3O2 |
| Molecular Weight | 405.89 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 2-chloro-N-[(2E)-2-phenyl-2-[(2-phenylacetyl)hydrazinylidene]ethyl]benzamide |
| SMILES | O=C(Cc1ccccc1)N/N=C(/CNC(=O)c1ccccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C23H20ClN3O2/c24-20-14-8-7-13-19(20)23(29)25-16-21(18-11-5-2-6-12-18)26-27-22(28)15-17-9-3-1-4-10-17/h1-14H,15-16H2,(H,25,29)(H,27,28)/b26-21- |
| InChIKey | AKTDZKTXVIZVBM-QLYXXIJNSA-N |
| XLogP | 3.83 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.89 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|