C29H24ClN3O2 — CID 16761074
4-chloro-N-[2-oxo-2-[(2E)-2-[2-phenyl-1-(4-phenylphenyl)ethylidene]hydrazinyl]ethyl]benzamide (PubChem CID 16761074) has the molecular formula C29H24ClN3O2 and a molecular weight of 481.98 g/mol. Its IUPAC name is 4-chloro-N-[2-oxo-2-[(2E)-2-[2-phenyl-1-(4-phenylphenyl)ethylidene]hydrazinyl]ethyl]benzamide.
| Compound Name | 4-chloro-N-[2-oxo-2-[(2E)-2-[2-phenyl-1-(4-phenylphenyl)ethylidene]hydrazinyl]ethyl]benzamide |
|---|---|
| PubChem CID | 16761074 |
| Molecular Formula | C29H24ClN3O2 |
| Molecular Weight | 481.98 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | 4-chloro-N-[2-oxo-2-[(2E)-2-[2-phenyl-1-(4-phenylphenyl)ethylidene]hydrazinyl]ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccc(Cl)cc1)N/N=C(\Cc1ccccc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H24ClN3O2/c30-26-17-15-25(16-18-26)29(35)31-20-28(34)33-32-27(19-21-7-3-1-4-8-21)24-13-11-23(12-14-24)22-9-5-2-6-10-22/h1-18H,19-20H2,(H,31,35)(H,33,34)/b32-27+ |
| InChIKey | HSMAKNRUSOEBKQ-QVAGMWBUSA-N |
| XLogP | 5.50 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.98 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|