C17H17N3O4 — CID 4129362
2-(4-propan-2-yloxyphenyl)-2-(pyridine-4-carbonylhydrazinylidene)acetic acid (PubChem CID 4129362) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is 2-(4-propan-2-yloxyphenyl)-2-(pyridine-4-carbonylhydrazinylidene)acetic acid.
| Compound Name | 2-(4-propan-2-yloxyphenyl)-2-(pyridine-4-carbonylhydrazinylidene)acetic acid |
|---|---|
| PubChem CID | 4129362 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 2-(4-propan-2-yloxyphenyl)-2-(pyridine-4-carbonylhydrazinylidene)acetic acid |
| SMILES | CC(C)Oc1ccc(C(=NNC(=O)c2ccncc2)C(=O)O)cc1 |
| InChI | InChI=1S/C17H17N3O4/c1-11(2)24-14-5-3-12(4-6-14)15(17(22)23)19-20-16(21)13-7-9-18-10-8-13/h3-11H,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | JZWYXENRCOACBU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|