C23H14ClNO3 — CID 7946519
2-chloro-N-[3-[(1,3-dioxoinden-2-ylidene)methyl]phenyl]benzamide (PubChem CID 7946519) has the molecular formula C23H14ClNO3 and a molecular weight of 387.82 g/mol. Its IUPAC name is 2-chloro-N-[3-[(1,3-dioxoinden-2-ylidene)methyl]phenyl]benzamide.
| Compound Name | 2-chloro-N-[3-[(1,3-dioxoinden-2-ylidene)methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 7946519 |
| Molecular Formula | C23H14ClNO3 |
| Molecular Weight | 387.82 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | 2-chloro-N-[3-[(1,3-dioxoinden-2-ylidene)methyl]phenyl]benzamide |
| SMILES | O=C(Nc1cccc(C=C2C(=O)c3ccccc3C2=O)c1)c1ccccc1Cl |
| InChI | InChI=1S/C23H14ClNO3/c24-20-11-4-3-10-18(20)23(28)25-15-7-5-6-14(12-15)13-19-21(26)16-8-1-2-9-17(16)22(19)27/h1-13H,(H,25,28) |
| InChIKey | MYTVWSVQDYWSIC-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.82 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|