C22H18ClN3O2 — CID 46803956
2-chloro-N-[3-[(E)-[(2-phenylacetyl)hydrazinylidene]methyl]phenyl]benzamide (PubChem CID 46803956) has the molecular formula C22H18ClN3O2 and a molecular weight of 391.86 g/mol. Its IUPAC name is 2-chloro-N-[3-[(E)-[(2-phenylacetyl)hydrazinylidene]methyl]phenyl]benzamide.
| Compound Name | 2-chloro-N-[3-[(E)-[(2-phenylacetyl)hydrazinylidene]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 46803956 |
| Molecular Formula | C22H18ClN3O2 |
| Molecular Weight | 391.86 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 2-chloro-N-[3-[(E)-[(2-phenylacetyl)hydrazinylidene]methyl]phenyl]benzamide |
| SMILES | O=C(Cc1ccccc1)N/N=C/c1cccc(NC(=O)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C22H18ClN3O2/c23-20-12-5-4-11-19(20)22(28)25-18-10-6-9-17(13-18)15-24-26-21(27)14-16-7-2-1-3-8-16/h1-13,15H,14H2,(H,25,28)(H,26,27)/b24-15+ |
| InChIKey | RCKXLDBOFKSTHY-BUVRLJJBSA-N |
| XLogP | 4.29 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.86 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|