C23H21ClN4O3 — CID 42991489
2-chloro-N-[3-[(E)-[[2-(2-methoxyanilino)acetyl]hydrazinylidene]methyl]phenyl]benzamide (PubChem CID 42991489) has the molecular formula C23H21ClN4O3 and a molecular weight of 436.90 g/mol. Its IUPAC name is 2-chloro-N-[3-[(E)-[[2-(2-methoxyanilino)acetyl]hydrazinylidene]methyl]phenyl]benzamide.
| Compound Name | 2-chloro-N-[3-[(E)-[[2-(2-methoxyanilino)acetyl]hydrazinylidene]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 42991489 |
| Molecular Formula | C23H21ClN4O3 |
| Molecular Weight | 436.90 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 2-chloro-N-[3-[(E)-[[2-(2-methoxyanilino)acetyl]hydrazinylidene]methyl]phenyl]benzamide |
| SMILES | COc1ccccc1NCC(=O)N/N=C/c1cccc(NC(=O)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C23H21ClN4O3/c1-31-21-12-5-4-11-20(21)25-15-22(29)28-26-14-16-7-6-8-17(13-16)27-23(30)18-9-2-3-10-19(18)24/h2-14,25H,15H2,1H3,(H,27,30)(H,28,29)/b26-14+ |
| InChIKey | CNZNKMDXLDJHGG-VULFUBBASA-N |
| XLogP | 4.16 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.90 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|